C6H2F10O — CID 166486272
1,1,1,2,2,3,3-heptafluoro-3-(2,3,3-trifluoroprop-1-enoxy)propane (PubChem CID 166486272) has the molecular formula C6H2F10O and a molecular weight of 280.06 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-(2,3,3-trifluoroprop-1-enoxy)propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-(2,3,3-trifluoroprop-1-enoxy)propane |
|---|---|
| PubChem CID | 166486272 |
| Molecular Formula | C6H2F10O |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-(2,3,3-trifluoroprop-1-enoxy)propane |
| SMILES | FC(=COC(F)(F)C(F)(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C6H2F10O/c7-2(3(8)9)1-17-6(15,16)4(10,11)5(12,13)14/h1,3H |
| InChIKey | VNSPCWQHWJYVDK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|