C4H2F4O — CID 174819569
(E)-2,3,4,4-tetrafluorobut-2-enal (PubChem CID 174819569) has the molecular formula C4H2F4O and a molecular weight of 142.05 g/mol. Its IUPAC name is (E)-2,3,4,4-tetrafluorobut-2-enal.
| Compound Name | (E)-2,3,4,4-tetrafluorobut-2-enal |
|---|---|
| PubChem CID | 174819569 |
| Molecular Formula | C4H2F4O |
| Molecular Weight | 142.05 g/mol |
| Exact Mass | 142.00 |
| IUPAC Name | (E)-2,3,4,4-tetrafluorobut-2-enal |
| SMILES | O=C/C(F)=C(\F)C(F)F |
| InChI | InChI=1S/C4H2F4O/c5-2(1-9)3(6)4(7)8/h1,4H/b3-2+ |
| InChIKey | CUTOUUWZYXRPAB-NSCUHMNNSA-N |
| XLogP | 1.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.05 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|