C4H6F2N2O — CID 145239038
N-(3,3-difluoroprop-1-en-2-ylamino)formamide (PubChem CID 145239038) has the molecular formula C4H6F2N2O and a molecular weight of 136.10 g/mol. Its IUPAC name is N-(3,3-difluoroprop-1-en-2-ylamino)formamide.
| Compound Name | N-(3,3-difluoroprop-1-en-2-ylamino)formamide |
|---|---|
| PubChem CID | 145239038 |
| Molecular Formula | C4H6F2N2O |
| Molecular Weight | 136.10 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | N-(3,3-difluoroprop-1-en-2-ylamino)formamide |
| SMILES | C=C(NNC=O)C(F)F |
| InChI | InChI=1S/C4H6F2N2O/c1-3(4(5)6)8-7-2-9/h2,4,8H,1H2,(H,7,9) |
| InChIKey | CPVXHYGMKKFDCA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.10 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|