C7H15N3O2 — CID 170202980
N-[[(2S)-2-amino-4-methylpentanoyl]amino]formamide (PubChem CID 170202980) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is N-[[(2S)-2-amino-4-methylpentanoyl]amino]formamide.
| Compound Name | N-[[(2S)-2-amino-4-methylpentanoyl]amino]formamide |
|---|---|
| PubChem CID | 170202980 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-[[(2S)-2-amino-4-methylpentanoyl]amino]formamide |
| SMILES | CC(C)C[C@H](N)C(=O)NNC=O |
| InChI | InChI=1S/C7H15N3O2/c1-5(2)3-6(8)7(12)10-9-4-11/h4-6H,3,8H2,1-2H3,(H,9,11)(H,10,12)/t6-/m0/s1 |
| InChIKey | RJXGUSSCBBMNHF-LURJTMIESA-N |
| XLogP | -0.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|