C6H8F4N2 — CID 118063031
(E)-N-[(E)-1,1-difluoropropan-2-ylideneamino]-1,1-difluoropropan-2-imine (PubChem CID 118063031) has the molecular formula C6H8F4N2 and a molecular weight of 184.14 g/mol. Its IUPAC name is (E)-N-[(E)-1,1-difluoropropan-2-ylideneamino]-1,1-difluoropropan-2-imine.
| Compound Name | (E)-N-[(E)-1,1-difluoropropan-2-ylideneamino]-1,1-difluoropropan-2-imine |
|---|---|
| PubChem CID | 118063031 |
| Molecular Formula | C6H8F4N2 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (E)-N-[(E)-1,1-difluoropropan-2-ylideneamino]-1,1-difluoropropan-2-imine |
| SMILES | C/C(=N\N=C(/C)C(F)F)C(F)F |
| InChI | InChI=1S/C6H8F4N2/c1-3(5(7)8)11-12-4(2)6(9)10/h5-6H,1-2H3/b11-3+,12-4+ |
| InChIKey | FZTAZMSABBMEKG-HMMKTVFPSA-N |
| XLogP | 2.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|