C3H5F2NO — CID 22769389
(NZ)-N-(1,1-difluoropropan-2-ylidene)hydroxylamine (PubChem CID 22769389) has the molecular formula C3H5F2NO and a molecular weight of 109.07 g/mol. Its IUPAC name is (NZ)-N-(1,1-difluoropropan-2-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(1,1-difluoropropan-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 22769389 |
| Molecular Formula | C3H5F2NO |
| Molecular Weight | 109.07 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | (NZ)-N-(1,1-difluoropropan-2-ylidene)hydroxylamine |
| SMILES | C/C(=N/O)C(F)F |
| InChI | InChI=1S/C3H5F2NO/c1-2(6-7)3(4)5/h3,7H,1H3/b6-2- |
| InChIKey | VNWVMFRXDOXYPP-KXFIGUGUSA-N |
| XLogP | 1.10 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.07 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|