C5H7Cl2F2NO — CID 173452074
N-(4,4-dichloro-1,1-difluoro-3-methylbutan-2-ylidene)hydroxylamine (PubChem CID 173452074) has the molecular formula C5H7Cl2F2NO and a molecular weight of 206.02 g/mol. Its IUPAC name is N-(4,4-dichloro-1,1-difluoro-3-methylbutan-2-ylidene)hydroxylamine.
| Compound Name | N-(4,4-dichloro-1,1-difluoro-3-methylbutan-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 173452074 |
| Molecular Formula | C5H7Cl2F2NO |
| Molecular Weight | 206.02 g/mol |
| Exact Mass | 204.99 |
| IUPAC Name | N-(4,4-dichloro-1,1-difluoro-3-methylbutan-2-ylidene)hydroxylamine |
| SMILES | CC(C(=NO)C(F)F)C(Cl)Cl |
| InChI | InChI=1S/C5H7Cl2F2NO/c1-2(4(6)7)3(10-11)5(8)9/h2,4-5,11H,1H3 |
| InChIKey | PIJPGYYEDCQQME-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.02 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|