C7H12F3NO — CID 146656420
(NZ)-N-(1,1,1-trifluoro-2,4-dimethylpentan-3-ylidene)hydroxylamine (PubChem CID 146656420) has the molecular formula C7H12F3NO and a molecular weight of 183.17 g/mol. Its IUPAC name is (NZ)-N-(1,1,1-trifluoro-2,4-dimethylpentan-3-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(1,1,1-trifluoro-2,4-dimethylpentan-3-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 146656420 |
| Molecular Formula | C7H12F3NO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (NZ)-N-(1,1,1-trifluoro-2,4-dimethylpentan-3-ylidene)hydroxylamine |
| SMILES | CC(C)/C(=N/O)C(C)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO/c1-4(2)6(11-12)5(3)7(8,9)10/h4-5,12H,1-3H3/b11-6- |
| InChIKey | ZNXDPXSUFWRYRG-WDZFZDKYSA-N |
| XLogP | 2.67 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|