C5H6F7HfO- — CID 173465008
hafnium;1,1,1,2-tetrafluoroethane;1,1,1-trifluoropropan-2-ol (PubChem CID 173465008) has the molecular formula C5H6F7HfO- and a molecular weight of 393.58 g/mol. Its IUPAC name is hafnium;1,1,1,2-tetrafluoroethane;1,1,1-trifluoropropan-2-ol.
| Compound Name | hafnium;1,1,1,2-tetrafluoroethane;1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 173465008 |
| Molecular Formula | C5H6F7HfO- |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | hafnium;1,1,1,2-tetrafluoroethane;1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)C(F)(F)F.F[CH-]C(F)(F)F.[Hf] |
| InChI | InChI=1S/C3H5F3O.C2HF4.Hf/c1-2(7)3(4,5)6;3-1-2(4,5)6;/h2,7H,1H3;1H;/q;-1; |
| InChIKey | VZRAVGQTYAVBRH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|