C8H14F4O — CID 162572819
(4R)-1,1,1,5-tetrafluoro-3,3,4-trimethylpentan-2-ol (PubChem CID 162572819) has the molecular formula C8H14F4O and a molecular weight of 202.19 g/mol. Its IUPAC name is (4R)-1,1,1,5-tetrafluoro-3,3,4-trimethylpentan-2-ol.
| Compound Name | (4R)-1,1,1,5-tetrafluoro-3,3,4-trimethylpentan-2-ol |
|---|---|
| PubChem CID | 162572819 |
| Molecular Formula | C8H14F4O |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (4R)-1,1,1,5-tetrafluoro-3,3,4-trimethylpentan-2-ol |
| SMILES | C[C@@H](CF)C(C)(C)C(O)C(F)(F)F |
| InChI | InChI=1S/C8H14F4O/c1-5(4-9)7(2,3)6(13)8(10,11)12/h5-6,13H,4H2,1-3H3/t5-,6?/m0/s1 |
| InChIKey | XBECKHIULAKPBK-ZBHICJROSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |