C8H17F5O3 — CID 161162971
2,2-difluoropropan-1-ol;ethanol;1,1,1-trifluoropropan-2-ol (PubChem CID 161162971) has the molecular formula C8H17F5O3 and a molecular weight of 256.21 g/mol. Its IUPAC name is 2,2-difluoropropan-1-ol;ethanol;1,1,1-trifluoropropan-2-ol.
| Compound Name | 2,2-difluoropropan-1-ol;ethanol;1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 161162971 |
| Molecular Formula | C8H17F5O3 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2,2-difluoropropan-1-ol;ethanol;1,1,1-trifluoropropan-2-ol |
| SMILES | CC(F)(F)CO.CC(O)C(F)(F)F.CCO |
| InChI | InChI=1S/C3H5F3O.C3H6F2O.C2H6O/c1-2(7)3(4,5)6;1-3(4,5)2-6;1-2-3/h2,7H,1H3;6H,2H2,1H3;3H,2H2,1H3 |
| InChIKey | UQDXBXMTPJNXRM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |