C6H10Cl2 — CID 142049943
4,4-dichloro-2,3-dimethylbut-1-ene (PubChem CID 142049943) has the molecular formula C6H10Cl2 and a molecular weight of 153.05 g/mol. Its IUPAC name is 4,4-dichloro-2,3-dimethylbut-1-ene.
| Compound Name | 4,4-dichloro-2,3-dimethylbut-1-ene |
|---|---|
| PubChem CID | 142049943 |
| Molecular Formula | C6H10Cl2 |
| Molecular Weight | 153.05 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 4,4-dichloro-2,3-dimethylbut-1-ene |
| SMILES | C=C(C)C(C)C(Cl)Cl |
| InChI | InChI=1S/C6H10Cl2/c1-4(2)5(3)6(7)8/h5-6H,1H2,2-3H3 |
| InChIKey | RVJLDDYOCYPIDY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.05 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|