C13H26S — CID 163218774
3-methylbutane-2-thione;(3S)-2,3,4-trimethylpent-1-ene (PubChem CID 163218774) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is 3-methylbutane-2-thione;(3S)-2,3,4-trimethylpent-1-ene.
| Compound Name | 3-methylbutane-2-thione;(3S)-2,3,4-trimethylpent-1-ene |
|---|---|
| PubChem CID | 163218774 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 3-methylbutane-2-thione;(3S)-2,3,4-trimethylpent-1-ene |
| SMILES | C=C(C)[C@@H](C)C(C)C.CC(=S)C(C)C |
| InChI | InChI=1S/C8H16.C5H10S/c1-6(2)8(5)7(3)4;1-4(2)5(3)6/h7-8H,1H2,2-5H3;4H,1-3H3/t8-;/m1./s1 |
| InChIKey | JATTZHORQHOHCG-DDWIOCJRSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|