C15H30 — CID 163218839
acetylene;2-methylbutane;(3S)-2,3,4-trimethylpent-1-ene (PubChem CID 163218839) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is acetylene;2-methylbutane;(3S)-2,3,4-trimethylpent-1-ene.
| Compound Name | acetylene;2-methylbutane;(3S)-2,3,4-trimethylpent-1-ene |
|---|---|
| PubChem CID | 163218839 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | acetylene;2-methylbutane;(3S)-2,3,4-trimethylpent-1-ene |
| SMILES | C#C.C=C(C)[C@@H](C)C(C)C.CCC(C)C |
| InChI | InChI=1S/C8H16.C5H12.C2H2/c1-6(2)8(5)7(3)4;1-4-5(2)3;1-2/h7-8H,1H2,2-5H3;5H,4H2,1-3H3;1-2H/t8-;;/m1../s1 |
| InChIKey | GPUBPFDBECUAQK-YCBDHFTFSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|