About (3S)-3,4-dimethylpentane-2-thione
(3S)-3,4-dimethylpentane-2-thione (PubChem CID 153298287) has the molecular formula C7H14S
and a molecular weight of 130.26 g/mol. Its IUPAC name is (3S)-3,4-dimethylpentane-2-thione.
Molecular Properties
| Compound Name | (3S)-3,4-dimethylpentane-2-thione |
| PubChem CID | 153298287 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | (3S)-3,4-dimethylpentane-2-thione |
| SMILES | CC(=S)[C@@H](C)C(C)C |
| InChI | InChI=1S/C7H14S/c1-5(2)6(3)7(4)8/h5-6H,1-4H3/t6-/m0/s1 |
| InChIKey | AGYYDEHLPAANAD-LURJTMIESA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3,4-dimethylpentane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,4-dimethylpentane-2-thione?
The IUPAC name of (3S)-3,4-dimethylpentane-2-thione (CID 153298287) is (3S)-3,4-dimethylpentane-2-thione.
What is the SMILES notation for (3S)-3,4-dimethylpentane-2-thione?
The canonical SMILES for (3S)-3,4-dimethylpentane-2-thione is CC(=S)[C@@H](C)C(C)C.
What is the InChIKey of (3S)-3,4-dimethylpentane-2-thione?
The InChIKey is AGYYDEHLPAANAD-LURJTMIESA-N. The full InChI is InChI=1S/C7H14S/c1-5(2)6(3)7(4)8/h5-6H,1-4H3/t6-/m0/s1.
What are the key properties of (3S)-3,4-dimethylpentane-2-thione?
(3S)-3,4-dimethylpentane-2-thione has a molecular weight of 130.26 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,4-dimethylpentane-2-thione is sourced from PubChem (CID 153298287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).