C8H16S — CID 153298597
(3R)-3,5-dimethylhexane-2-thione (PubChem CID 153298597) has the molecular formula C8H16S and a molecular weight of 144.28 g/mol. Its IUPAC name is (3R)-3,5-dimethylhexane-2-thione.
| Compound Name | (3R)-3,5-dimethylhexane-2-thione |
|---|---|
| PubChem CID | 153298597 |
| Molecular Formula | C8H16S |
| Molecular Weight | 144.28 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (3R)-3,5-dimethylhexane-2-thione |
| SMILES | CC(=S)[C@H](C)CC(C)C |
| InChI | InChI=1S/C8H16S/c1-6(2)5-7(3)8(4)9/h6-7H,5H2,1-4H3/t7-/m1/s1 |
| InChIKey | RBBORZVJAZTDMU-SSDOTTSWSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|