C10H19NO2 — CID 118582646
4-methyl-2-(methylamino)-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one (PubChem CID 118582646) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-methyl-2-(methylamino)-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one.
| Compound Name | 4-methyl-2-(methylamino)-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 118582646 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-methyl-2-(methylamino)-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one |
| SMILES | CNC(CC(C)C)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C10H19NO2/c1-7(2)5-8(11-4)9(12)10(3)6-13-10/h7-8,11H,5-6H2,1-4H3/t8?,10-/m1/s1 |
| InChIKey | SSHFBOKTXCIBAQ-LHIURRSHSA-N |
| XLogP | 0.98 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|