C15H26N2O5 — CID 123966003
[2-(methylamino)-3-[[1-(2-methyloxiran-2-yl)-1-oxobutan-2-yl]amino]-3-oxopropyl] 2-methylpropanoate (PubChem CID 123966003) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is [2-(methylamino)-3-[[1-(2-methyloxiran-2-yl)-1-oxobutan-2-yl]amino]-3-oxopropyl] 2-methylpropanoate.
| Compound Name | [2-(methylamino)-3-[[1-(2-methyloxiran-2-yl)-1-oxobutan-2-yl]amino]-3-oxopropyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 123966003 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | [2-(methylamino)-3-[[1-(2-methyloxiran-2-yl)-1-oxobutan-2-yl]amino]-3-oxopropyl] 2-methylpropanoate |
| SMILES | CCC(NC(=O)C(COC(=O)C(C)C)NC)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C15H26N2O5/c1-6-10(12(18)15(4)8-22-15)17-13(19)11(16-5)7-21-14(20)9(2)3/h9-11,16H,6-8H2,1-5H3,(H,17,19) |
| InChIKey | ZZVKDTHODZLTBM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|