C10H17NO4 — CID 122640384
[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]carbamic acid (PubChem CID 122640384) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is [4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 122640384 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | [4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(C)CC(NC(=O)O)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C10H17NO4/c1-6(2)4-7(11-9(13)14)8(12)10(3)5-15-10/h6-7,11H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | QYVVDTPUMNBIDV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|