C9H18NO2P — CID 170087255
(2R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-2-(phosphanylamino)pentan-1-one (PubChem CID 170087255) has the molecular formula C9H18NO2P and a molecular weight of 203.22 g/mol. Its IUPAC name is (2R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-2-(phosphanylamino)pentan-1-one.
| Compound Name | (2R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-2-(phosphanylamino)pentan-1-one |
|---|---|
| PubChem CID | 170087255 |
| Molecular Formula | C9H18NO2P |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (2R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-2-(phosphanylamino)pentan-1-one |
| SMILES | CC(C)C[C@@H](NP)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C9H18NO2P/c1-6(2)4-7(10-13)8(11)9(3)5-12-9/h6-7,10H,4-5,13H2,1-3H3/t7-,9-/m1/s1 |
| InChIKey | VCBMUSPMXFPYPN-VXNVDRBHSA-N |
| XLogP | 1.14 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|