About 3,4-dimethylpentan-2-one;sulfane
3,4-dimethylpentan-2-one;sulfane (PubChem CID 158809949) has the molecular formula C7H16OS
and a molecular weight of 148.27 g/mol. Its IUPAC name is 3,4-dimethylpentan-2-one;sulfane.
Molecular Properties
| Compound Name | 3,4-dimethylpentan-2-one;sulfane |
| PubChem CID | 158809949 |
| Molecular Formula | C7H16OS |
| Molecular Weight | 148.27 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 3,4-dimethylpentan-2-one;sulfane |
| SMILES | CC(=O)C(C)C(C)C.S |
| InChI | InChI=1S/C7H14O.H2S/c1-5(2)6(3)7(4)8;/h5-6H,1-4H3;1H2 |
| InChIKey | IUOACEWCCPPEOE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethylpentan-2-one;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylpentan-2-one;sulfane?
The IUPAC name of 3,4-dimethylpentan-2-one;sulfane (CID 158809949) is 3,4-dimethylpentan-2-one;sulfane.
What is the SMILES notation for 3,4-dimethylpentan-2-one;sulfane?
The canonical SMILES for 3,4-dimethylpentan-2-one;sulfane is CC(=O)C(C)C(C)C.S.
What is the InChIKey of 3,4-dimethylpentan-2-one;sulfane?
The InChIKey is IUOACEWCCPPEOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.H2S/c1-5(2)6(3)7(4)8;/h5-6H,1-4H3;1H2.
What are the key properties of 3,4-dimethylpentan-2-one;sulfane?
3,4-dimethylpentan-2-one;sulfane has a molecular weight of 148.27 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylpentan-2-one;sulfane is sourced from PubChem (CID 158809949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).