C9H18O2 — CID 58201940
4-methoxy-3,5-dimethylhexan-2-one (PubChem CID 58201940) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethylhexan-2-one.
| Compound Name | 4-methoxy-3,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 58201940 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 4-methoxy-3,5-dimethylhexan-2-one |
| SMILES | COC(C(C)C)C(C)C(C)=O |
| InChI | InChI=1S/C9H18O2/c1-6(2)9(11-5)7(3)8(4)10/h6-7,9H,1-5H3 |
| InChIKey | GRPAWNDYTBQXKF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |