C10H18O3 — CID 58201906
4-methoxy-3,6-dimethylheptane-2,5-dione (PubChem CID 58201906) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-methoxy-3,6-dimethylheptane-2,5-dione.
| Compound Name | 4-methoxy-3,6-dimethylheptane-2,5-dione |
|---|---|
| PubChem CID | 58201906 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 4-methoxy-3,6-dimethylheptane-2,5-dione |
| SMILES | COC(C(=O)C(C)C)C(C)C(C)=O |
| InChI | InChI=1S/C10H18O3/c1-6(2)9(12)10(13-5)7(3)8(4)11/h6-7,10H,1-5H3 |
| InChIKey | UKYWRADFWOTRPC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |