C20H40O8PtSi2+2 — CID 175720802
bis(3-[dimethoxy(methyl)silyl]-5-methylhexane-2,4-dione);platinum(2+) (PubChem CID 175720802) has the molecular formula C20H40O8PtSi2+2 and a molecular weight of 659.78 g/mol. Its IUPAC name is bis(3-[dimethoxy(methyl)silyl]-5-methylhexane-2,4-dione);platinum(2+).
| Compound Name | bis(3-[dimethoxy(methyl)silyl]-5-methylhexane-2,4-dione);platinum(2+) |
|---|---|
| PubChem CID | 175720802 |
| Molecular Formula | C20H40O8PtSi2+2 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | bis(3-[dimethoxy(methyl)silyl]-5-methylhexane-2,4-dione);platinum(2+) |
| SMILES | CO[Si](C)(OC)C(C(C)=O)C(=O)C(C)C.CO[Si](C)(OC)C(C(C)=O)C(=O)C(C)C.[Pt+2] |
| InChI | InChI=1S/2C10H20O4Si.Pt/c2*1-7(2)9(12)10(8(3)11)15(6,13-4)14-5;/h2*7,10H,1-6H3;/q;;+2 |
| InChIKey | PFHYAYPLSZTZPS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|