C14H28O4Si — CID 175720790
4-[dimethoxy(propan-2-yl)silyl]-2,6-dimethylheptane-3,5-dione (PubChem CID 175720790) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is 4-[dimethoxy(propan-2-yl)silyl]-2,6-dimethylheptane-3,5-dione.
| Compound Name | 4-[dimethoxy(propan-2-yl)silyl]-2,6-dimethylheptane-3,5-dione |
|---|---|
| PubChem CID | 175720790 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 4-[dimethoxy(propan-2-yl)silyl]-2,6-dimethylheptane-3,5-dione |
| SMILES | CO[Si](OC)(C(C)C)C(C(=O)C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C14H28O4Si/c1-9(2)12(15)14(13(16)10(3)4)19(17-7,18-8)11(5)6/h9-11,14H,1-8H3 |
| InChIKey | DKTZHFSUEATIPA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|