C20H28F12O8PtSi2+2 — CID 175720623
bis(3-[dimethoxy(propan-2-yl)silyl]-1,1,1,5,5,5-hexafluoropentane-2,4-dione);platinum(2+) (PubChem CID 175720623) has the molecular formula C20H28F12O8PtSi2+2 and a molecular weight of 875.66 g/mol. Its IUPAC name is bis(3-[dimethoxy(propan-2-yl)silyl]-1,1,1,5,5,5-hexafluoropentane-2,4-dione);platinum(2+).
| Compound Name | bis(3-[dimethoxy(propan-2-yl)silyl]-1,1,1,5,5,5-hexafluoropentane-2,4-dione);platinum(2+) |
|---|---|
| PubChem CID | 175720623 |
| Molecular Formula | C20H28F12O8PtSi2+2 |
| Molecular Weight | 875.66 g/mol |
| Exact Mass | 875.08 |
| IUPAC Name | bis(3-[dimethoxy(propan-2-yl)silyl]-1,1,1,5,5,5-hexafluoropentane-2,4-dione);platinum(2+) |
| SMILES | CO[Si](OC)(C(C)C)C(C(=O)C(F)(F)F)C(=O)C(F)(F)F.CO[Si](OC)(C(C)C)C(C(=O)C(F)(F)F)C(=O)C(F)(F)F.[Pt+2] |
| InChI | InChI=1S/2C10H14F6O4Si.Pt/c2*1-5(2)21(19-3,20-4)6(7(17)9(11,12)13)8(18)10(14,15)16;/h2*5-6H,1-4H3;/q;;+2 |
| InChIKey | PDECJYFMTGQDIN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|