C8H11F3O3 — CID 72737807
methyl 4,4,4-trifluoro-3-oxo-2-propan-2-ylbutanoate (PubChem CID 72737807) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is methyl 4,4,4-trifluoro-3-oxo-2-propan-2-ylbutanoate.
| Compound Name | methyl 4,4,4-trifluoro-3-oxo-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 72737807 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | methyl 4,4,4-trifluoro-3-oxo-2-propan-2-ylbutanoate |
| SMILES | COC(=O)C(C(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C8H11F3O3/c1-4(2)5(7(13)14-3)6(12)8(9,10)11/h4-5H,1-3H3 |
| InChIKey | LMYIRPXEUFFYAW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|