About ethaneperoxoic acid;methoxymethane
ethaneperoxoic acid;methoxymethane (PubChem CID 87834215) has the molecular formula C4H10O4
and a molecular weight of 122.12 g/mol. Its IUPAC name is ethaneperoxoic acid;methoxymethane.
Molecular Properties
| Compound Name | ethaneperoxoic acid;methoxymethane |
| PubChem CID | 87834215 |
| Molecular Formula | C4H10O4 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | ethaneperoxoic acid;methoxymethane |
| SMILES | CC(=O)OO.COC |
| InChI | InChI=1S/C2H4O3.C2H6O/c1-2(3)5-4;1-3-2/h4H,1H3;1-2H3 |
| InChIKey | BGYMNOMFJXZFFQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethaneperoxoic acid;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethaneperoxoic acid;methoxymethane?
The IUPAC name of ethaneperoxoic acid;methoxymethane (CID 87834215) is ethaneperoxoic acid;methoxymethane.
What is the SMILES notation for ethaneperoxoic acid;methoxymethane?
The canonical SMILES for ethaneperoxoic acid;methoxymethane is CC(=O)OO.COC.
What is the InChIKey of ethaneperoxoic acid;methoxymethane?
The InChIKey is BGYMNOMFJXZFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.C2H6O/c1-2(3)5-4;1-3-2/h4H,1H3;1-2H3.
What are the key properties of ethaneperoxoic acid;methoxymethane?
ethaneperoxoic acid;methoxymethane has a molecular weight of 122.12 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethaneperoxoic acid;methoxymethane is sourced from PubChem (CID 87834215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).