About ethaneperoxoic acid;yttrium
ethaneperoxoic acid;yttrium (PubChem CID 88646363) has the molecular formula C2H4O3Y
and a molecular weight of 164.96 g/mol. Its IUPAC name is ethaneperoxoic acid;yttrium.
Molecular Properties
| Compound Name | ethaneperoxoic acid;yttrium |
| PubChem CID | 88646363 |
| Molecular Formula | C2H4O3Y |
| Molecular Weight | 164.96 g/mol |
| Exact Mass | 164.92 |
| IUPAC Name | ethaneperoxoic acid;yttrium |
| SMILES | CC(=O)OO.[Y] |
| InChI | InChI=1S/C2H4O3.Y/c1-2(3)5-4;/h4H,1H3; |
| InChIKey | BLLDGLBZEXUNDJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.96 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethaneperoxoic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethaneperoxoic acid;yttrium?
The IUPAC name of ethaneperoxoic acid;yttrium (CID 88646363) is ethaneperoxoic acid;yttrium.
What is the SMILES notation for ethaneperoxoic acid;yttrium?
The canonical SMILES for ethaneperoxoic acid;yttrium is CC(=O)OO.[Y].
What is the InChIKey of ethaneperoxoic acid;yttrium?
The InChIKey is BLLDGLBZEXUNDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.Y/c1-2(3)5-4;/h4H,1H3;.
What are the key properties of ethaneperoxoic acid;yttrium?
ethaneperoxoic acid;yttrium has a molecular weight of 164.96 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethaneperoxoic acid;yttrium is sourced from PubChem (CID 88646363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).