About ethane;ethaneperoxoic acid;methanamine
ethane;ethaneperoxoic acid;methanamine (PubChem CID 159871057) has the molecular formula C7H21NO3
and a molecular weight of 167.25 g/mol. Its IUPAC name is ethane;ethaneperoxoic acid;methanamine.
Molecular Properties
| Compound Name | ethane;ethaneperoxoic acid;methanamine |
| PubChem CID | 159871057 |
| Molecular Formula | C7H21NO3 |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | ethane;ethaneperoxoic acid;methanamine |
| SMILES | CC.CC.CC(=O)OO.CN |
| InChI | InChI=1S/C2H4O3.2C2H6.CH5N/c1-2(3)5-4;3*1-2/h4H,1H3;2*1-2H3;2H2,1H3 |
| InChIKey | NSIQNGPCTMERQH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethaneperoxoic acid;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethaneperoxoic acid;methanamine?
The IUPAC name of ethane;ethaneperoxoic acid;methanamine (CID 159871057) is ethane;ethaneperoxoic acid;methanamine.
What is the SMILES notation for ethane;ethaneperoxoic acid;methanamine?
The canonical SMILES for ethane;ethaneperoxoic acid;methanamine is CC.CC.CC(=O)OO.CN.
What is the InChIKey of ethane;ethaneperoxoic acid;methanamine?
The InChIKey is NSIQNGPCTMERQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.2C2H6.CH5N/c1-2(3)5-4;3*1-2/h4H,1H3;2*1-2H3;2H2,1H3.
What are the key properties of ethane;ethaneperoxoic acid;methanamine?
ethane;ethaneperoxoic acid;methanamine has a molecular weight of 167.25 g/mol, XLogP of 1.65, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethaneperoxoic acid;methanamine is sourced from PubChem (CID 159871057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).