About sodium;ethaneperoxoic acid;acetate
sodium;ethaneperoxoic acid;acetate (PubChem CID 87103299) has the molecular formula C4H7NaO5
and a molecular weight of 158.08 g/mol. Its IUPAC name is sodium;ethaneperoxoic acid;acetate.
Molecular Properties
| Compound Name | sodium;ethaneperoxoic acid;acetate |
| PubChem CID | 87103299 |
| Molecular Formula | C4H7NaO5 |
| Molecular Weight | 158.08 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | sodium;ethaneperoxoic acid;acetate |
| SMILES | CC(=O)OO.CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H4O3.C2H4O2.Na/c1-2(3)5-4;1-2(3)4;/h4H,1H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | FEYUMJOJLZVAOT-UHFFFAOYSA-M |
| XLogP | -4.22 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.08 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethaneperoxoic acid;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethaneperoxoic acid;acetate?
The IUPAC name of sodium;ethaneperoxoic acid;acetate (CID 87103299) is sodium;ethaneperoxoic acid;acetate.
What is the SMILES notation for sodium;ethaneperoxoic acid;acetate?
The canonical SMILES for sodium;ethaneperoxoic acid;acetate is CC(=O)OO.CC(=O)[O-].[Na+].
What is the InChIKey of sodium;ethaneperoxoic acid;acetate?
The InChIKey is FEYUMJOJLZVAOT-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O3.C2H4O2.Na/c1-2(3)5-4;1-2(3)4;/h4H,1H3;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;ethaneperoxoic acid;acetate?
sodium;ethaneperoxoic acid;acetate has a molecular weight of 158.08 g/mol, XLogP of -4.22, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethaneperoxoic acid;acetate is sourced from PubChem (CID 87103299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).