C8H14I2O4 — CID 162151114
3,4-dimethoxyhexane-2,5-dione;molecular iodine (PubChem CID 162151114) has the molecular formula C8H14I2O4 and a molecular weight of 428.00 g/mol. Its IUPAC name is 3,4-dimethoxyhexane-2,5-dione;molecular iodine.
| Compound Name | 3,4-dimethoxyhexane-2,5-dione;molecular iodine |
|---|---|
| PubChem CID | 162151114 |
| Molecular Formula | C8H14I2O4 |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.90 |
| IUPAC Name | 3,4-dimethoxyhexane-2,5-dione;molecular iodine |
| SMILES | COC(C(C)=O)C(OC)C(C)=O.II |
| InChI | InChI=1S/C8H14O4.I2/c1-5(9)7(11-3)8(12-4)6(2)10;1-2/h7-8H,1-4H3; |
| InChIKey | ZLFKMLDUNLKZPO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|