C10H18O2 — CID 87291199
(E)-5-methoxy-4,6-dimethylhept-3-en-2-one (PubChem CID 87291199) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (E)-5-methoxy-4,6-dimethylhept-3-en-2-one.
| Compound Name | (E)-5-methoxy-4,6-dimethylhept-3-en-2-one |
|---|---|
| PubChem CID | 87291199 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (E)-5-methoxy-4,6-dimethylhept-3-en-2-one |
| SMILES | COC(/C(C)=C/C(C)=O)C(C)C |
| InChI | InChI=1S/C10H18O2/c1-7(2)10(12-5)8(3)6-9(4)11/h6-7,10H,1-5H3/b8-6+ |
| InChIKey | JDPVBENNGRNFCU-SOFGYWHQSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|