About CID 140513856
CID 140513856 (PubChem CID 140513856) has the molecular formula C10H14InO4
and a molecular weight of 313.04 g/mol.
Molecular Properties
| Compound Name | CID 140513856 |
| PubChem CID | 140513856 |
| Molecular Formula | C10H14InO4 |
| Molecular Weight | 313.04 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O[In]O/C(C)=C\C(C)=O |
| InChI | InChI=1S/2C5H8O2.In/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | PNQBJFCPCHLXLR-FDGPNNRMSA-L |
| XLogP | 1.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.04 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 140513856 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140513856?
The IUPAC name of CID 140513856 (CID 140513856) is not available.
What is the SMILES notation for CID 140513856?
The canonical SMILES for CID 140513856 is CC(=O)/C=C(/C)O[In]O/C(C)=C\C(C)=O.
What is the InChIKey of CID 140513856?
The InChIKey is PNQBJFCPCHLXLR-FDGPNNRMSA-L. The full InChI is InChI=1S/2C5H8O2.In/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-;.
What are the key properties of CID 140513856?
CID 140513856 has a molecular weight of 313.04 g/mol, XLogP of 1.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140513856 is sourced from PubChem (CID 140513856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).