About methane;3-methoxypentan-2-one
methane;3-methoxypentan-2-one (PubChem CID 158529059) has the molecular formula C8H20O2
and a molecular weight of 148.25 g/mol. Its IUPAC name is methane;3-methoxypentan-2-one.
Molecular Properties
| Compound Name | methane;3-methoxypentan-2-one |
| PubChem CID | 158529059 |
| Molecular Formula | C8H20O2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.15 |
| IUPAC Name | methane;3-methoxypentan-2-one |
| SMILES | C.C.CCC(OC)C(C)=O |
| InChI | InChI=1S/C6H12O2.2CH4/c1-4-6(8-3)5(2)7;;/h6H,4H2,1-3H3;2*1H4 |
| InChIKey | HNDIIXILJYDQQN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;3-methoxypentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methoxypentan-2-one?
The IUPAC name of methane;3-methoxypentan-2-one (CID 158529059) is methane;3-methoxypentan-2-one.
What is the SMILES notation for methane;3-methoxypentan-2-one?
The canonical SMILES for methane;3-methoxypentan-2-one is C.C.CCC(OC)C(C)=O.
What is the InChIKey of methane;3-methoxypentan-2-one?
The InChIKey is HNDIIXILJYDQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.2CH4/c1-4-6(8-3)5(2)7;;/h6H,4H2,1-3H3;2*1H4.
What are the key properties of methane;3-methoxypentan-2-one?
methane;3-methoxypentan-2-one has a molecular weight of 148.25 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methoxypentan-2-one is sourced from PubChem (CID 158529059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).