C10H18O2 — CID 91349574
5-methoxy-3,4-dimethylhept-3-en-2-one (PubChem CID 91349574) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 5-methoxy-3,4-dimethylhept-3-en-2-one.
| Compound Name | 5-methoxy-3,4-dimethylhept-3-en-2-one |
|---|---|
| PubChem CID | 91349574 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 5-methoxy-3,4-dimethylhept-3-en-2-one |
| SMILES | CCC(OC)C(C)=C(C)C(C)=O |
| InChI | InChI=1S/C10H18O2/c1-6-10(12-5)8(3)7(2)9(4)11/h10H,6H2,1-5H3 |
| InChIKey | XXPSBNOOERIVPL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|