methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid

C8H13F3O5 — CID 87814494

IUPACmethyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid
SMILESCCC(OC)C(=O)OC.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12O3.C2HF3O2/c1-4-5(8-2)6(7)9-3;3-2(4,5)1(6)7/h5H,4H2,1-3H3;(H,6,7)
InChIKeyVIBXHTSDKJTWIE-UHFFFAOYSA-N
MW246.18 g/mol
LogP1.22
Rot. Bonds3

About methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid

methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid (PubChem CID 87814494) has the molecular formula C8H13F3O5 and a molecular weight of 246.18 g/mol. Its IUPAC name is methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namemethyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid
PubChem CID87814494
Molecular FormulaC8H13F3O5
Molecular Weight246.18 g/mol
Exact Mass246.07
IUPAC Namemethyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid
SMILESCCC(OC)C(=O)OC.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12O3.C2HF3O2/c1-4-5(8-2)6(7)9-3;3-2(4,5)1(6)7/h5H,4H2,1-3H3;(H,6,7)
InChIKeyVIBXHTSDKJTWIE-UHFFFAOYSA-N
XLogP1.22
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.18
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid?
The IUPAC name of methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid (CID 87814494) is methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid?
The canonical SMILES for methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid is CCC(OC)C(=O)OC.O=C(O)C(F)(F)F.
What is the InChIKey of methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid?
The InChIKey is VIBXHTSDKJTWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C2HF3O2/c1-4-5(8-2)6(7)9-3;3-2(4,5)1(6)7/h5H,4H2,1-3H3;(H,6,7).
What are the key properties of methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid?
methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid has a molecular weight of 246.18 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methoxybutanoate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 87814494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).