C7H10F3NO4 — CID 131127978
2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 131127978) has the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. Its IUPAC name is 2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid.
| Compound Name | 2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 131127978 |
| Molecular Formula | C7H10F3NO4 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
| SMILES | COC(CCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H10F3NO4/c1-15-4(5(12)13)2-3-11-6(14)7(8,9)10/h4H,2-3H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | OQYIVFWEZUMZHQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |