About methyl (2R)-2-methoxypentanoate
methyl (2R)-2-methoxypentanoate (PubChem CID 30403288) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is methyl (2R)-2-methoxypentanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-methoxypentanoate |
| PubChem CID | 30403288 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | methyl (2R)-2-methoxypentanoate |
| SMILES | CCC[C@@H](OC)C(=O)OC |
| InChI | InChI=1S/C7H14O3/c1-4-5-6(9-2)7(8)10-3/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | NHTDLPGAPVMZMC-ZCFIWIBFSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-2-methoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-methoxypentanoate?
The IUPAC name of methyl (2R)-2-methoxypentanoate (CID 30403288) is methyl (2R)-2-methoxypentanoate.
What is the SMILES notation for methyl (2R)-2-methoxypentanoate?
The canonical SMILES for methyl (2R)-2-methoxypentanoate is CCC[C@@H](OC)C(=O)OC.
What is the InChIKey of methyl (2R)-2-methoxypentanoate?
The InChIKey is NHTDLPGAPVMZMC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H14O3/c1-4-5-6(9-2)7(8)10-3/h6H,4-5H2,1-3H3/t6-/m1/s1.
What are the key properties of methyl (2R)-2-methoxypentanoate?
methyl (2R)-2-methoxypentanoate has a molecular weight of 146.19 g/mol, XLogP of 0.97, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-methoxypentanoate is sourced from PubChem (CID 30403288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).