About 3-methoxy-2-oxohexanal
3-methoxy-2-oxohexanal (PubChem CID 91124811) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-methoxy-2-oxohexanal.
Molecular Properties
| Compound Name | 3-methoxy-2-oxohexanal |
| PubChem CID | 91124811 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 3-methoxy-2-oxohexanal |
| SMILES | CCCC(OC)C(=O)C=O |
| InChI | InChI=1S/C7H12O3/c1-3-4-7(10-2)6(9)5-8/h5,7H,3-4H2,1-2H3 |
| InChIKey | XIXQJWHNVTWWHS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-2-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-oxohexanal?
The IUPAC name of 3-methoxy-2-oxohexanal (CID 91124811) is 3-methoxy-2-oxohexanal.
What is the SMILES notation for 3-methoxy-2-oxohexanal?
The canonical SMILES for 3-methoxy-2-oxohexanal is CCCC(OC)C(=O)C=O.
What is the InChIKey of 3-methoxy-2-oxohexanal?
The InChIKey is XIXQJWHNVTWWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-4-7(10-2)6(9)5-8/h5,7H,3-4H2,1-2H3.
What are the key properties of 3-methoxy-2-oxohexanal?
3-methoxy-2-oxohexanal has a molecular weight of 144.17 g/mol, XLogP of 0.57, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-oxohexanal is sourced from PubChem (CID 91124811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).