About dimethyl 2-methoxyhexanedioate
dimethyl 2-methoxyhexanedioate (PubChem CID 589322) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is dimethyl 2-methoxyhexanedioate.
Molecular Properties
| Compound Name | dimethyl 2-methoxyhexanedioate |
| PubChem CID | 589322 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | dimethyl 2-methoxyhexanedioate |
| SMILES | COC(=O)CCCC(OC)C(=O)OC |
| InChI | InChI=1S/C9H16O5/c1-12-7(9(11)14-3)5-4-6-8(10)13-2/h7H,4-6H2,1-3H3 |
| InChIKey | RITACHAZMSSGQU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 2-methoxyhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-methoxyhexanedioate?
The IUPAC name of dimethyl 2-methoxyhexanedioate (CID 589322) is dimethyl 2-methoxyhexanedioate.
What is the SMILES notation for dimethyl 2-methoxyhexanedioate?
The canonical SMILES for dimethyl 2-methoxyhexanedioate is COC(=O)CCCC(OC)C(=O)OC.
What is the InChIKey of dimethyl 2-methoxyhexanedioate?
The InChIKey is RITACHAZMSSGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-12-7(9(11)14-3)5-4-6-8(10)13-2/h7H,4-6H2,1-3H3.
What are the key properties of dimethyl 2-methoxyhexanedioate?
dimethyl 2-methoxyhexanedioate has a molecular weight of 204.22 g/mol, XLogP of 0.52, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-methoxyhexanedioate is sourced from PubChem (CID 589322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).