2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid

C13H22O6 — CID 87194998

IUPAC2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid
SMILESCCC(OC)C(=C(CC(=O)O)C(=O)O)C(CC)OC
InChIInChI=1S/C13H22O6/c1-5-9(18-3)12(10(6-2)19-4)8(13(16)17)7-11(14)15/h9-10H,5-7H2,1-4H3,(H,14,15)(H,16,17)
InChIKeyLWUBFRMVMUCOLX-UHFFFAOYSA-N
MW274.31 g/mol
LogP1.69
Rot. Bonds9

About 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid

2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid (PubChem CID 87194998) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid.

Molecular Properties

Compound Name2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid
PubChem CID87194998
Molecular FormulaC13H22O6
Molecular Weight274.31 g/mol
Exact Mass274.14
IUPAC Name2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid
SMILESCCC(OC)C(=C(CC(=O)O)C(=O)O)C(CC)OC
InChIInChI=1S/C13H22O6/c1-5-9(18-3)12(10(6-2)19-4)8(13(16)17)7-11(14)15/h9-10H,5-7H2,1-4H3,(H,14,15)(H,16,17)
InChIKeyLWUBFRMVMUCOLX-UHFFFAOYSA-N
XLogP1.69
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.31
LogP ≤ 51.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid?
The IUPAC name of 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid (CID 87194998) is 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid.
What is the SMILES notation for 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid?
The canonical SMILES for 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid is CCC(OC)C(=C(CC(=O)O)C(=O)O)C(CC)OC.
What is the InChIKey of 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid?
The InChIKey is LWUBFRMVMUCOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O6/c1-5-9(18-3)12(10(6-2)19-4)8(13(16)17)7-11(14)15/h9-10H,5-7H2,1-4H3,(H,14,15)(H,16,17).
What are the key properties of 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid?
2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid has a molecular weight of 274.31 g/mol, XLogP of 1.69, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid is sourced from PubChem (CID 87194998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).