C13H22O6 — CID 87194998
2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid (PubChem CID 87194998) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid.
| Compound Name | 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid |
|---|---|
| PubChem CID | 87194998 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-(3,5-dimethoxyheptan-4-ylidene)butanedioic acid |
| SMILES | CCC(OC)C(=C(CC(=O)O)C(=O)O)C(CC)OC |
| InChI | InChI=1S/C13H22O6/c1-5-9(18-3)12(10(6-2)19-4)8(13(16)17)7-11(14)15/h9-10H,5-7H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | LWUBFRMVMUCOLX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|