C13H14O4 — CID 90001381
2-(3,5-dimethylhepta-1,6-diyn-4-ylidene)butanedioic acid (PubChem CID 90001381) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-(3,5-dimethylhepta-1,6-diyn-4-ylidene)butanedioic acid.
| Compound Name | 2-(3,5-dimethylhepta-1,6-diyn-4-ylidene)butanedioic acid |
|---|---|
| PubChem CID | 90001381 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(3,5-dimethylhepta-1,6-diyn-4-ylidene)butanedioic acid |
| SMILES | C#CC(C)C(=C(CC(=O)O)C(=O)O)C(C)C#C |
| InChI | InChI=1S/C13H14O4/c1-5-8(3)12(9(4)6-2)10(13(16)17)7-11(14)15/h1-2,8-9H,7H2,3-4H3,(H,14,15)(H,16,17) |
| InChIKey | BIWYCCMJZVGLOS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|