2-but-3-yn-2-yl-2-methylbutanedioic acid

C9H12O4 — CID 88550616

IUPAC2-but-3-yn-2-yl-2-methylbutanedioic acid
SMILESC#CC(C)C(C)(CC(=O)O)C(=O)O
InChIInChI=1S/C9H12O4/c1-4-6(2)9(3,8(12)13)5-7(10)11/h1,6H,5H2,2-3H3,(H,10,11)(H,12,13)
InChIKeySBAAAUPTMDYGHC-UHFFFAOYSA-N
MW184.19 g/mol
LogP0.82
Rot. Bonds4

About 2-but-3-yn-2-yl-2-methylbutanedioic acid

2-but-3-yn-2-yl-2-methylbutanedioic acid (PubChem CID 88550616) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-but-3-yn-2-yl-2-methylbutanedioic acid.

Molecular Properties

Compound Name2-but-3-yn-2-yl-2-methylbutanedioic acid
PubChem CID88550616
Molecular FormulaC9H12O4
Molecular Weight184.19 g/mol
Exact Mass184.07
IUPAC Name2-but-3-yn-2-yl-2-methylbutanedioic acid
SMILESC#CC(C)C(C)(CC(=O)O)C(=O)O
InChIInChI=1S/C9H12O4/c1-4-6(2)9(3,8(12)13)5-7(10)11/h1,6H,5H2,2-3H3,(H,10,11)(H,12,13)
InChIKeySBAAAUPTMDYGHC-UHFFFAOYSA-N
XLogP0.82
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-but-3-yn-2-yl-2-methylbutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-but-3-yn-2-yl-2-methylpropanedioic acid
CID 87459391
(2R,3R)-2-hydroxy-2,3-dimethylpent-4-ynoic acid
CID 165346508
2-(1-hydroxypropyl)-2-methylbutanedioic acid
CID 174477504
2-(diphosphonomethyl)-2-methylbutanedioic acid
CID 21245619
3-amino-3,4-dimethylpentanoic acid
CID 53414110
3-hydroxy-4,4-dimethyl-3-propan-2-ylpentanoic acid
CID 83697497
4-(hex-5-ynylamino)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid
CID 106208691
2-(3,5-dimethylhepta-1,6-diyn-4-ylidene)butanedioic acid
CID 90001381
2,2-dimethylbutanedioic acid;hydrochloride
CID 87625816
3,3-dimethyl-5-oxo-5-(pent-1-yn-3-ylamino)pentanoic acid
CID 106223896
2-(hydroxymethyl)-2,3-dimethylhexanedioic acid
CID 91573436
4-(dimethylamino)-3,3,5-trimethylhexanoic acid
CID 116908193

Frequently Asked Questions

What is the IUPAC name of 2-but-3-yn-2-yl-2-methylbutanedioic acid?
The IUPAC name of 2-but-3-yn-2-yl-2-methylbutanedioic acid (CID 88550616) is 2-but-3-yn-2-yl-2-methylbutanedioic acid.
What is the SMILES notation for 2-but-3-yn-2-yl-2-methylbutanedioic acid?
The canonical SMILES for 2-but-3-yn-2-yl-2-methylbutanedioic acid is C#CC(C)C(C)(CC(=O)O)C(=O)O.
What is the InChIKey of 2-but-3-yn-2-yl-2-methylbutanedioic acid?
The InChIKey is SBAAAUPTMDYGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-4-6(2)9(3,8(12)13)5-7(10)11/h1,6H,5H2,2-3H3,(H,10,11)(H,12,13).
What are the key properties of 2-but-3-yn-2-yl-2-methylbutanedioic acid?
2-but-3-yn-2-yl-2-methylbutanedioic acid has a molecular weight of 184.19 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-yn-2-yl-2-methylbutanedioic acid is sourced from PubChem (CID 88550616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).