C18H28N2O2 — CID 142746556
N,N'-bis(but-3-yn-2-yl)decanediamide (PubChem CID 142746556) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N,N'-bis(but-3-yn-2-yl)decanediamide.
| Compound Name | N,N'-bis(but-3-yn-2-yl)decanediamide |
|---|---|
| PubChem CID | 142746556 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N,N'-bis(but-3-yn-2-yl)decanediamide |
| SMILES | C#CC(C)NC(=O)CCCCCCCCC(=O)NC(C)C#C |
| InChI | InChI=1S/C18H28N2O2/c1-5-15(3)19-17(21)13-11-9-7-8-10-12-14-18(22)20-16(4)6-2/h1-2,15-16H,7-14H2,3-4H3,(H,19,21)(H,20,22) |
| InChIKey | GRPOUWBXXQTMGD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|