About 4-methylhex-5-ynoic acid
4-methylhex-5-ynoic acid (PubChem CID 54051986) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 4-methylhex-5-ynoic acid.
Molecular Properties
| Compound Name | 4-methylhex-5-ynoic acid |
| PubChem CID | 54051986 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 4-methylhex-5-ynoic acid |
| SMILES | C#CC(C)CCC(=O)O |
| InChI | InChI=1S/C7H10O2/c1-3-6(2)4-5-7(8)9/h1,6H,4-5H2,2H3,(H,8,9) |
| InChIKey | YSMFQOSQEMHGSD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylhex-5-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylhex-5-ynoic acid?
The IUPAC name of 4-methylhex-5-ynoic acid (CID 54051986) is 4-methylhex-5-ynoic acid.
What is the SMILES notation for 4-methylhex-5-ynoic acid?
The canonical SMILES for 4-methylhex-5-ynoic acid is C#CC(C)CCC(=O)O.
What is the InChIKey of 4-methylhex-5-ynoic acid?
The InChIKey is YSMFQOSQEMHGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-3-6(2)4-5-7(8)9/h1,6H,4-5H2,2H3,(H,8,9).
What are the key properties of 4-methylhex-5-ynoic acid?
4-methylhex-5-ynoic acid has a molecular weight of 126.15 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylhex-5-ynoic acid is sourced from PubChem (CID 54051986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).