About 4-cyanopentanoic acid;2-methylpropan-2-ol
4-cyanopentanoic acid;2-methylpropan-2-ol (PubChem CID 161310964) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-cyanopentanoic acid;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 4-cyanopentanoic acid;2-methylpropan-2-ol |
| PubChem CID | 161310964 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 4-cyanopentanoic acid;2-methylpropan-2-ol |
| SMILES | CC(C#N)CCC(=O)O.CC(C)(C)O |
| InChI | InChI=1S/C6H9NO2.C4H10O/c1-5(4-7)2-3-6(8)9;1-4(2,3)5/h5H,2-3H2,1H3,(H,8,9);5H,1-3H3 |
| InChIKey | VIWOGYWCVLJFPM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyanopentanoic acid;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanopentanoic acid;2-methylpropan-2-ol?
The IUPAC name of 4-cyanopentanoic acid;2-methylpropan-2-ol (CID 161310964) is 4-cyanopentanoic acid;2-methylpropan-2-ol.
What is the SMILES notation for 4-cyanopentanoic acid;2-methylpropan-2-ol?
The canonical SMILES for 4-cyanopentanoic acid;2-methylpropan-2-ol is CC(C#N)CCC(=O)O.CC(C)(C)O.
What is the InChIKey of 4-cyanopentanoic acid;2-methylpropan-2-ol?
The InChIKey is VIWOGYWCVLJFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.C4H10O/c1-5(4-7)2-3-6(8)9;1-4(2,3)5/h5H,2-3H2,1H3,(H,8,9);5H,1-3H3.
What are the key properties of 4-cyanopentanoic acid;2-methylpropan-2-ol?
4-cyanopentanoic acid;2-methylpropan-2-ol has a molecular weight of 201.27 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanopentanoic acid;2-methylpropan-2-ol is sourced from PubChem (CID 161310964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).