About methyl 4-cyanopentanoate;pentanoic acid
methyl 4-cyanopentanoate;pentanoic acid (PubChem CID 175240233) has the molecular formula C12H21NO4
and a molecular weight of 243.30 g/mol. Its IUPAC name is methyl 4-cyanopentanoate;pentanoic acid.
Molecular Properties
| Compound Name | methyl 4-cyanopentanoate;pentanoic acid |
| PubChem CID | 175240233 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | methyl 4-cyanopentanoate;pentanoic acid |
| SMILES | CCCCC(=O)O.COC(=O)CCC(C)C#N |
| InChI | InChI=1S/C7H11NO2.C5H10O2/c1-6(5-8)3-4-7(9)10-2;1-2-3-4-5(6)7/h6H,3-4H2,1-2H3;2-4H2,1H3,(H,6,7) |
| InChIKey | UPSMQAGDCDZIPI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-cyanopentanoate;pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-cyanopentanoate;pentanoic acid?
The IUPAC name of methyl 4-cyanopentanoate;pentanoic acid (CID 175240233) is methyl 4-cyanopentanoate;pentanoic acid.
What is the SMILES notation for methyl 4-cyanopentanoate;pentanoic acid?
The canonical SMILES for methyl 4-cyanopentanoate;pentanoic acid is CCCCC(=O)O.COC(=O)CCC(C)C#N.
What is the InChIKey of methyl 4-cyanopentanoate;pentanoic acid?
The InChIKey is UPSMQAGDCDZIPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.C5H10O2/c1-6(5-8)3-4-7(9)10-2;1-2-3-4-5(6)7/h6H,3-4H2,1-2H3;2-4H2,1H3,(H,6,7).
What are the key properties of methyl 4-cyanopentanoate;pentanoic acid?
methyl 4-cyanopentanoate;pentanoic acid has a molecular weight of 243.30 g/mol, XLogP of 2.36, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyanopentanoate;pentanoic acid is sourced from PubChem (CID 175240233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).