About methyl 4-cyanohexanoate
methyl 4-cyanohexanoate (PubChem CID 13096120) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is methyl 4-cyanohexanoate.
Molecular Properties
| Compound Name | methyl 4-cyanohexanoate |
| PubChem CID | 13096120 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | methyl 4-cyanohexanoate |
| SMILES | CCC(C#N)CCC(=O)OC |
| InChI | InChI=1S/C8H13NO2/c1-3-7(6-9)4-5-8(10)11-2/h7H,3-5H2,1-2H3 |
| InChIKey | CRWDFLBDKUHLLG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-cyanohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-cyanohexanoate?
The IUPAC name of methyl 4-cyanohexanoate (CID 13096120) is methyl 4-cyanohexanoate.
What is the SMILES notation for methyl 4-cyanohexanoate?
The canonical SMILES for methyl 4-cyanohexanoate is CCC(C#N)CCC(=O)OC.
What is the InChIKey of methyl 4-cyanohexanoate?
The InChIKey is CRWDFLBDKUHLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-3-7(6-9)4-5-8(10)11-2/h7H,3-5H2,1-2H3.
What are the key properties of methyl 4-cyanohexanoate?
methyl 4-cyanohexanoate has a molecular weight of 155.20 g/mol, XLogP of 1.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyanohexanoate is sourced from PubChem (CID 13096120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).