2,2-dicyano-4,5-dimethyloctanedioic acid

C12H16N2O4 — CID 22505831

IUPAC2,2-dicyano-4,5-dimethyloctanedioic acid
SMILESCC(CCC(=O)O)C(C)CC(C#N)(C#N)C(=O)O
InChIInChI=1S/C12H16N2O4/c1-8(3-4-10(15)16)9(2)5-12(6-13,7-14)11(17)18/h8-9H,3-5H2,1-2H3,(H,15,16)(H,17,18)
InChIKeyWHFVKDWOBHCLFD-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.63
Rot. Bonds7

About 2,2-dicyano-4,5-dimethyloctanedioic acid

2,2-dicyano-4,5-dimethyloctanedioic acid (PubChem CID 22505831) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2,2-dicyano-4,5-dimethyloctanedioic acid.

Molecular Properties

Compound Name2,2-dicyano-4,5-dimethyloctanedioic acid
PubChem CID22505831
Molecular FormulaC12H16N2O4
Molecular Weight252.27 g/mol
Exact Mass252.11
IUPAC Name2,2-dicyano-4,5-dimethyloctanedioic acid
SMILESCC(CCC(=O)O)C(C)CC(C#N)(C#N)C(=O)O
InChIInChI=1S/C12H16N2O4/c1-8(3-4-10(15)16)9(2)5-12(6-13,7-14)11(17)18/h8-9H,3-5H2,1-2H3,(H,15,16)(H,17,18)
InChIKeyWHFVKDWOBHCLFD-UHFFFAOYSA-N
XLogP1.63
TPSA122.18 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,2-dicyano-4,5-dimethyloctanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dicyano-4,5-dimethyloctanedioic acid?
The IUPAC name of 2,2-dicyano-4,5-dimethyloctanedioic acid (CID 22505831) is 2,2-dicyano-4,5-dimethyloctanedioic acid.
What is the SMILES notation for 2,2-dicyano-4,5-dimethyloctanedioic acid?
The canonical SMILES for 2,2-dicyano-4,5-dimethyloctanedioic acid is CC(CCC(=O)O)C(C)CC(C#N)(C#N)C(=O)O.
What is the InChIKey of 2,2-dicyano-4,5-dimethyloctanedioic acid?
The InChIKey is WHFVKDWOBHCLFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-8(3-4-10(15)16)9(2)5-12(6-13,7-14)11(17)18/h8-9H,3-5H2,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 2,2-dicyano-4,5-dimethyloctanedioic acid?
2,2-dicyano-4,5-dimethyloctanedioic acid has a molecular weight of 252.27 g/mol, XLogP of 1.63, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyano-4,5-dimethyloctanedioic acid is sourced from PubChem (CID 22505831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).